C7H13N3OS — CID 96656461
4-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 96656461) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 4-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 96656461 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-[(2-methoxyethylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | COCCNCc1csc(N)n1 |
| InChI | InChI=1S/C7H13N3OS/c1-11-3-2-9-4-6-5-12-7(8)10-6/h5,9H,2-4H2,1H3,(H2,8,10) |
| InChIKey | HZLIFGKUEBNSNL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|