C8H14N2OS2 — CID 63857547
4-(3-methoxypropylsulfanylmethyl)-1,3-thiazol-2-amine (PubChem CID 63857547) has the molecular formula C8H14N2OS2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 4-(3-methoxypropylsulfanylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-methoxypropylsulfanylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63857547 |
| Molecular Formula | C8H14N2OS2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(3-methoxypropylsulfanylmethyl)-1,3-thiazol-2-amine |
| SMILES | COCCCSCc1csc(N)n1 |
| InChI | InChI=1S/C8H14N2OS2/c1-11-3-2-4-12-5-7-6-13-8(9)10-7/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | WCMXYGLDELEDKS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|