C8H12N2O2S2 — CID 43617626
methyl 3-[(2-amino-1,3-thiazol-4-yl)methylsulfanyl]propanoate (PubChem CID 43617626) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is methyl 3-[(2-amino-1,3-thiazol-4-yl)methylsulfanyl]propanoate.
| Compound Name | methyl 3-[(2-amino-1,3-thiazol-4-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 43617626 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | methyl 3-[(2-amino-1,3-thiazol-4-yl)methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1csc(N)n1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-12-7(11)2-3-13-4-6-5-14-8(9)10-6/h5H,2-4H2,1H3,(H2,9,10) |
| InChIKey | SDXZLEWFJUQOAK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|