C7H13N3S2 — CID 66219976
4-(3-aminopropylsulfanylmethyl)-1,3-thiazol-2-amine (PubChem CID 66219976) has the molecular formula C7H13N3S2 and a molecular weight of 203.34 g/mol. Its IUPAC name is 4-(3-aminopropylsulfanylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-aminopropylsulfanylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 66219976 |
| Molecular Formula | C7H13N3S2 |
| Molecular Weight | 203.34 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 4-(3-aminopropylsulfanylmethyl)-1,3-thiazol-2-amine |
| SMILES | NCCCSCc1csc(N)n1 |
| InChI | InChI=1S/C7H13N3S2/c8-2-1-3-11-4-6-5-12-7(9)10-6/h5H,1-4,8H2,(H2,9,10) |
| InChIKey | MKFCBGYDGQPZFS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|