C9H17N7O2S3 — CID 12918382
3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-(methylsulfamoyl)propanimidamide (PubChem CID 12918382) has the molecular formula C9H17N7O2S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-(methylsulfamoyl)propanimidamide.
| Compound Name | 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-(methylsulfamoyl)propanimidamide |
|---|---|
| PubChem CID | 12918382 |
| Molecular Formula | C9H17N7O2S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]-N'-(methylsulfamoyl)propanimidamide |
| SMILES | CNS(=O)(=O)/N=C(\N)CCSCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C9H17N7O2S3/c1-13-21(17,18)16-7(10)2-3-19-4-6-5-20-9(14-6)15-8(11)12/h5,13H,2-4H2,1H3,(H2,10,16)(H4,11,12,14,15) |
| InChIKey | VAUMYKICKNTWID-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|