C10H15NO2S2 — CID 112725057
ethyl 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoate (PubChem CID 112725057) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is ethyl 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoate.
| Compound Name | ethyl 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 112725057 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | ethyl 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoate |
| SMILES | CCOC(=O)CCSCc1csc(C)n1 |
| InChI | InChI=1S/C10H15NO2S2/c1-3-13-10(12)4-5-14-6-9-7-15-8(2)11-9/h7H,3-6H2,1-2H3 |
| InChIKey | KGYOZLTYMAVFMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|