About ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate
ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate (PubChem CID 60812256) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate.
Analyze ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate?
The IUPAC name of ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate (CID 60812256) is ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate.
What is the SMILES notation for ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate?
The canonical SMILES for ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate is CCOC(=O)CNCc1csc(C)n1.
What is the InChIKey of ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate?
The InChIKey is AKXZZJFDDQHTJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-3-13-9(12)5-10-4-8-6-14-7(2)11-8/h6,10H,3-5H2,1-2H3.
What are the key properties of ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate?
ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate has a molecular weight of 214.29 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-methyl-1,3-thiazol-4-yl)methylamino]acetate is sourced from PubChem (CID 60812256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).