C12H21N3OS — CID 54935908
N,N-diethyl-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanamide (PubChem CID 54935908) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is N,N-diethyl-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanamide.
| Compound Name | N,N-diethyl-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 54935908 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N,N-diethyl-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanamide |
| SMILES | CCN(CC)C(=O)CCNCc1csc(C)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-4-15(5-2)12(16)6-7-13-8-11-9-17-10(3)14-11/h9,13H,4-8H2,1-3H3 |
| InChIKey | FEIHFNOEUXAWNA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|