C7H8NO2S2- — CID 7131479
2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate (PubChem CID 7131479) has the molecular formula C7H8NO2S2- and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 7131479 |
| Molecular Formula | C7H8NO2S2- |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetate |
| SMILES | Cc1nc(CSCC(=O)[O-])cs1 |
| InChI | InChI=1S/C7H9NO2S2/c1-5-8-6(3-12-5)2-11-4-7(9)10/h3H,2,4H2,1H3,(H,9,10)/p-1 |
| InChIKey | JIKOHTMQEPJNFC-UHFFFAOYSA-M |
| XLogP | 0.43 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |