About dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate
dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate (PubChem CID 9456487) has the molecular formula C17H17NO6S2
and a molecular weight of 395.46 g/mol. Its IUPAC name is dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate |
| PubChem CID | 9456487 |
| Molecular Formula | C17H17NO6S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)CSCc2csc(C)n2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H17NO6S2/c1-10-18-13(8-26-10)7-25-9-15(19)24-14-5-11(16(20)22-2)4-12(6-14)17(21)23-3/h4-6,8H,7,9H2,1-3H3 |
| InChIKey | MYKLRUZBPJCCPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate?
The IUPAC name of dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate (CID 9456487) is dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate is COC(=O)c1cc(OC(=O)CSCc2csc(C)n2)cc(C(=O)OC)c1.
What is the InChIKey of dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate?
The InChIKey is MYKLRUZBPJCCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO6S2/c1-10-18-13(8-26-10)7-25-9-15(19)24-14-5-11(16(20)22-2)4-12(6-14)17(21)23-3/h4-6,8H,7,9H2,1-3H3.
What are the key properties of dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate?
dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate has a molecular weight of 395.46 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-[2-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]acetyl]oxybenzene-1,3-dicarboxylate is sourced from PubChem (CID 9456487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).