C14H14ClNO2S — CID 55779468
(4-chloro-3,5-dimethylphenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate (PubChem CID 55779468) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 55779468 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate |
| SMILES | Cc1nc(CC(=O)Oc2cc(C)c(Cl)c(C)c2)cs1 |
| InChI | InChI=1S/C14H14ClNO2S/c1-8-4-12(5-9(2)14(8)15)18-13(17)6-11-7-19-10(3)16-11/h4-5,7H,6H2,1-3H3 |
| InChIKey | QQCQWCAYLYWYEK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|