C12H8Cl3NO2S — CID 55335110
(2,4,6-trichlorophenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate (PubChem CID 55335110) has the molecular formula C12H8Cl3NO2S and a molecular weight of 336.63 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate.
| Compound Name | (2,4,6-trichlorophenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 55335110 |
| Molecular Formula | C12H8Cl3NO2S |
| Molecular Weight | 336.63 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-(2-methyl-1,3-thiazol-4-yl)acetate |
| SMILES | Cc1nc(CC(=O)Oc2c(Cl)cc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C12H8Cl3NO2S/c1-6-16-8(5-19-6)4-11(17)18-12-9(14)2-7(13)3-10(12)15/h2-3,5H,4H2,1H3 |
| InChIKey | NBXRKGJXULBUNB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|