C14H13Cl2N3O2S — CID 135821378
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 135821378) has the molecular formula C14H13Cl2N3O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 135821378 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | C/C(=N\NC(=O)Cc1csc(C)n1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C14H13Cl2N3O2S/c1-7(11-3-9(15)4-12(16)14(11)21)18-19-13(20)5-10-6-22-8(2)17-10/h3-4,6,21H,5H2,1-2H3,(H,19,20)/b18-7+ |
| InChIKey | FAZFAKIAGLAJSC-CNHKJKLMSA-N |
| XLogP | 3.55 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|