C15H15Cl2N3OS — CID 9464064
N-[(Z)-1-(3,4-dichlorophenyl)propylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 9464064) has the molecular formula C15H15Cl2N3OS and a molecular weight of 356.28 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dichlorophenyl)propylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(Z)-1-(3,4-dichlorophenyl)propylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 9464064 |
| Molecular Formula | C15H15Cl2N3OS |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-[(Z)-1-(3,4-dichlorophenyl)propylideneamino]-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC/C(=N/NC(=O)Cc1csc(C)n1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N3OS/c1-3-14(10-4-5-12(16)13(17)6-10)19-20-15(21)7-11-8-22-9(2)18-11/h4-6,8H,3,7H2,1-2H3,(H,20,21)/b19-14- |
| InChIKey | RYADMRNWRMMZPP-RGEXLXHISA-N |
| XLogP | 4.23 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|