C20H18N4OS2 — CID 78583999
2-(2-methyl-1,3-thiazol-4-yl)-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]acetamide (PubChem CID 78583999) has the molecular formula C20H18N4OS2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 78583999 |
| Molecular Formula | C20H18N4OS2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)Cc1csc(C)n1)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C20H18N4OS2/c1-12(23-24-20(25)10-15-11-26-13(2)21-15)14-7-8-19-17(9-14)22-16-5-3-4-6-18(16)27-19/h3-9,11,22H,10H2,1-2H3,(H,24,25) |
| InChIKey | BTUNNTUVCGHQQN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|