C20H19N5S — CID 5199105
4,6-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]pyrimidin-2-amine (PubChem CID 5199105) has the molecular formula C20H19N5S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4,6-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 5199105 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4,6-dimethyl-N-[1-(10H-phenothiazin-2-yl)ethylideneamino]pyrimidin-2-amine |
| SMILES | CC(=NNc1nc(C)cc(C)n1)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C20H19N5S/c1-12-10-13(2)22-20(21-12)25-24-14(3)15-8-9-19-17(11-15)23-16-6-4-5-7-18(16)26-19/h4-11,23H,1-3H3,(H,21,22,25) |
| InChIKey | NOHASVSMAHSXMD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|