C16H16N4S2 — CID 7955538
1-methyl-3-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]thiourea (PubChem CID 7955538) has the molecular formula C16H16N4S2 and a molecular weight of 328.47 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 7955538 |
| Molecular Formula | C16H16N4S2 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-methyl-3-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C(/C)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C16H16N4S2/c1-10(19-20-16(21)17-2)11-7-8-15-13(9-11)18-12-5-3-4-6-14(12)22-15/h3-9,18H,1-2H3,(H2,17,20,21)/b19-10- |
| InChIKey | LHXFSOKCJJCPOA-GRSHGNNSSA-N |
| XLogP | 3.71 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|