C14H20N6S2 — CID 139163904
1-methyl-3-[(E)-1-[3-[(E)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenyl]ethylideneamino]thiourea (PubChem CID 139163904) has the molecular formula C14H20N6S2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 1-methyl-3-[(E)-1-[3-[(E)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenyl]ethylideneamino]thiourea.
| Compound Name | 1-methyl-3-[(E)-1-[3-[(E)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 139163904 |
| Molecular Formula | C14H20N6S2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-methyl-3-[(E)-1-[3-[(E)-C-methyl-N-(methylcarbamothioylamino)carbonimidoyl]phenyl]ethylideneamino]thiourea |
| SMILES | CNC(=S)N/N=C(\C)c1cccc(/C(C)=N/NC(=S)NC)c1 |
| InChI | InChI=1S/C14H20N6S2/c1-9(17-19-13(21)15-3)11-6-5-7-12(8-11)10(2)18-20-14(22)16-4/h5-8H,1-4H3,(H2,15,19,21)(H2,16,20,22)/b17-9+,18-10+ |
| InChIKey | SLTDFLGCSVLYTP-BEQMOXJMSA-N |
| XLogP | 1.32 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|