C10H13N3O2S — CID 135676243
1-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-methylthiourea (PubChem CID 135676243) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 135676243 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-[(E)-1-(2,4-dihydroxyphenyl)ethylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(\C)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H13N3O2S/c1-6(12-13-10(16)11-2)8-4-3-7(14)5-9(8)15/h3-5,14-15H,1-2H3,(H2,11,13,16)/b12-6+ |
| InChIKey | LPKARRQRAZZHIS-WUXMJOGZSA-N |
| XLogP | 0.92 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|