C14H16N4O2 — CID 142674599
4-[N-(2,4-diaminoanilino)-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 142674599) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-[N-(2,4-diaminoanilino)-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-(2,4-diaminoanilino)-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 142674599 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-[N-(2,4-diaminoanilino)-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CC(=NNc1ccc(N)cc1N)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H16N4O2/c1-8(11-4-3-10(19)7-14(11)20)17-18-13-5-2-9(15)6-12(13)16/h2-7,18-20H,15-16H2,1H3 |
| InChIKey | UUSLLCJJMRFILT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|