C10H14N2O2 — CID 137202429
4-[N-(dimethylamino)-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 137202429) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-[N-(dimethylamino)-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-(dimethylamino)-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 137202429 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-[N-(dimethylamino)-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CC(=NN(C)C)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H14N2O2/c1-7(11-12(2)3)9-5-4-8(13)6-10(9)14/h4-6,13-14H,1-3H3 |
| InChIKey | OMPQOAIKVQOPOB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|