C21H18N2O3 — CID 136734563
4-[N-[2-[(2-hydroxyphenyl)methylideneamino]phenyl]-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 136734563) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[N-[2-[(2-hydroxyphenyl)methylideneamino]phenyl]-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-[2-[(2-hydroxyphenyl)methylideneamino]phenyl]-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136734563 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-[N-[2-[(2-hydroxyphenyl)methylideneamino]phenyl]-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | C/C(=N\c1ccccc1/N=C/c1ccccc1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C21H18N2O3/c1-14(17-11-10-16(24)12-21(17)26)23-19-8-4-3-7-18(19)22-13-15-6-2-5-9-20(15)25/h2-13,24-26H,1H3/b22-13+,23-14+ |
| InChIKey | GAIJQWHJLIQCMF-MSKUYSOUSA-N |
| XLogP | 4.69 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|