About 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride
2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride (PubChem CID 175288392) has the molecular formula C14H13Cl3NOSTi
and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride.
Molecular Properties
| Compound Name | 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride |
| PubChem CID | 175288392 |
| Molecular Formula | C14H13Cl3NOSTi |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride |
| SMILES | CSc1ccccc1/N=C/c1ccccc1O.[Cl-].[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C14H13NOS.3ClH.Ti/c1-17-14-9-5-3-7-12(14)15-10-11-6-2-4-8-13(11)16;;;;/h2-10,16H,1H3;3*1H;/q;;;;+3/p-3/b15-10+;;;; |
| InChIKey | FSJMNUYVFYROIS-VYYKFXENSA-K |
| XLogP | -5.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | -5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride?
The IUPAC name of 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride (CID 175288392) is 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride.
What is the SMILES notation for 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride?
The canonical SMILES for 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride is CSc1ccccc1/N=C/c1ccccc1O.[Cl-].[Cl-].[Cl-].[Ti+3].
What is the InChIKey of 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride?
The InChIKey is FSJMNUYVFYROIS-VYYKFXENSA-K. The full InChI is InChI=1S/C14H13NOS.3ClH.Ti/c1-17-14-9-5-3-7-12(14)15-10-11-6-2-4-8-13(11)16;;;;/h2-10,16H,1H3;3*1H;/q;;;;+3/p-3/b15-10+;;;;.
What are the key properties of 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride?
2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride has a molecular weight of 397.56 g/mol, XLogP of -5.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylsulfanylphenyl)iminomethyl]phenol;titanium(3+);trichloride is sourced from PubChem (CID 175288392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).