C18H20BrNOS — CID 137247228
2-bromo-4-tert-butyl-6-[(2-methylsulfanylphenyl)iminomethyl]phenol (PubChem CID 137247228) has the molecular formula C18H20BrNOS and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-bromo-4-tert-butyl-6-[(2-methylsulfanylphenyl)iminomethyl]phenol.
| Compound Name | 2-bromo-4-tert-butyl-6-[(2-methylsulfanylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137247228 |
| Molecular Formula | C18H20BrNOS |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-bromo-4-tert-butyl-6-[(2-methylsulfanylphenyl)iminomethyl]phenol |
| SMILES | CSc1ccccc1/N=C/c1cc(C(C)(C)C)cc(Br)c1O |
| InChI | InChI=1S/C18H20BrNOS/c1-18(2,3)13-9-12(17(21)14(19)10-13)11-20-15-7-5-6-8-16(15)22-4/h5-11,21H,1-4H3/b20-11+ |
| InChIKey | XCQRHIQGSSAUGF-RGVLZGJSSA-N |
| XLogP | 5.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|