C38H54CrN2O2 — CID 155737356
chromium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol;ethane (PubChem CID 155737356) has the molecular formula C38H54CrN2O2 and a molecular weight of 622.86 g/mol. Its IUPAC name is chromium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol;ethane.
| Compound Name | chromium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol;ethane |
|---|---|
| PubChem CID | 155737356 |
| Molecular Formula | C38H54CrN2O2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.36 |
| IUPAC Name | chromium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol;ethane |
| SMILES | CC.CC(C)(C)c1cc(/C=N/c2ccccc2/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.[Cr] |
| InChI | InChI=1S/C36H48N2O2.C2H6.Cr/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;1-2;/h13-22,39-40H,1-12H3;1-2H3;/b37-21+,38-22+;; |
| InChIKey | UFSLTAVVDCNTKR-XIDIDSRISA-N |
| XLogP | 10.81 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|