C37H50AlClN2O2 — CID 155648257
2,4-ditert-butyl-6-[[2-[[3,5-ditert-butyl-2-[chloro(methyl)alumanyl]oxyphenyl]methylideneamino]phenyl]iminomethyl]phenol (PubChem CID 155648257) has the molecular formula C37H50AlClN2O2 and a molecular weight of 617.25 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-[[3,5-ditert-butyl-2-[chloro(methyl)alumanyl]oxyphenyl]methylideneamino]phenyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-[[3,5-ditert-butyl-2-[chloro(methyl)alumanyl]oxyphenyl]methylideneamino]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 155648257 |
| Molecular Formula | C37H50AlClN2O2 |
| Molecular Weight | 617.25 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-[[3,5-ditert-butyl-2-[chloro(methyl)alumanyl]oxyphenyl]methylideneamino]phenyl]iminomethyl]phenol |
| SMILES | C[Al](Cl)Oc1c(/C=N/c2ccccc2/N=C\c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C36H48N2O2.CH3.Al.ClH/c1-33(2,3)25-17-23(31(39)27(19-25)35(7,8)9)21-37-29-15-13-14-16-30(29)38-22-24-18-26(34(4,5)6)20-28(32(24)40)36(10,11)12;;;/h13-22,39-40H,1-12H3;1H3;;1H/q;;+2;/p-2/b37-21-,38-22+;;; |
| InChIKey | WINHMWPUSGESEQ-LBBLRVHFSA-L |
| XLogP | 10.82 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.25 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|