C22H29NO — CID 135980173
2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol (PubChem CID 135980173) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135980173 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2-methylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccccc1/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H29NO/c1-15-10-8-9-11-19(15)23-14-16-12-17(21(2,3)4)13-18(20(16)24)22(5,6)7/h8-14,24H,1-7H3/b23-14+ |
| InChIKey | NTAVIXPUIJKYDB-OEAKJJBVSA-N |
| XLogP | 6.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|