C57H69N3O3 — CID 137057879
2,4-ditert-butyl-6-[[2-(2,6-dimethylphenoxy)phenyl]iminomethyl]phenol;2,4-ditert-butyl-6-[[2-(N-methylanilino)phenyl]iminomethyl]phenol (PubChem CID 137057879) has the molecular formula C57H69N3O3 and a molecular weight of 844.20 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(2,6-dimethylphenoxy)phenyl]iminomethyl]phenol;2,4-ditert-butyl-6-[[2-(N-methylanilino)phenyl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-(2,6-dimethylphenoxy)phenyl]iminomethyl]phenol;2,4-ditert-butyl-6-[[2-(N-methylanilino)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137057879 |
| Molecular Formula | C57H69N3O3 |
| Molecular Weight | 844.20 g/mol |
| Exact Mass | 843.53 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(2,6-dimethylphenoxy)phenyl]iminomethyl]phenol;2,4-ditert-butyl-6-[[2-(N-methylanilino)phenyl]iminomethyl]phenol |
| SMILES | CN(c1ccccc1)c1ccccc1/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.Cc1cccc(C)c1Oc1ccccc1/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H35NO2.C28H34N2O/c1-19-12-11-13-20(2)27(19)32-25-15-10-9-14-24(25)30-18-21-16-22(28(3,4)5)17-23(26(21)31)29(6,7)8;1-27(2,3)21-17-20(26(31)23(18-21)28(4,5)6)19-29-24-15-11-12-16-25(24)30(7)22-13-9-8-10-14-22/h9-18,31H,1-8H3;8-19,31H,1-7H3/b30-18+;29-19+ |
| InChIKey | WBLORPIZJYBDPI-UAJCWNSASA-N |
| XLogP | 15.65 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.20 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|