C28H28F5NO2 — CID 143795555
1-(3,5-ditert-butyl-2-methoxyphenyl)-N-[2-(2,3,4,5,6-pentafluorophenoxy)phenyl]methanimine (PubChem CID 143795555) has the molecular formula C28H28F5NO2 and a molecular weight of 505.53 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-methoxyphenyl)-N-[2-(2,3,4,5,6-pentafluorophenoxy)phenyl]methanimine.
| Compound Name | 1-(3,5-ditert-butyl-2-methoxyphenyl)-N-[2-(2,3,4,5,6-pentafluorophenoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 143795555 |
| Molecular Formula | C28H28F5NO2 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-methoxyphenyl)-N-[2-(2,3,4,5,6-pentafluorophenoxy)phenyl]methanimine |
| SMILES | COc1c(/C=N/c2ccccc2Oc2c(F)c(F)c(F)c(F)c2F)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C28H28F5NO2/c1-27(2,3)16-12-15(25(35-7)17(13-16)28(4,5)6)14-34-18-10-8-9-11-19(18)36-26-23(32)21(30)20(29)22(31)24(26)33/h8-14H,1-7H3/b34-14+ |
| InChIKey | WRLLSLXDKFFWFB-HBHSWBPBSA-N |
| XLogP | 8.53 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|