C30H35NO3 — CID 58531885
2-[(3,5-ditert-butyl-2-methoxyphenyl)methylideneamino]-2,2-diphenylacetic acid (PubChem CID 58531885) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-2-methoxyphenyl)methylideneamino]-2,2-diphenylacetic acid.
| Compound Name | 2-[(3,5-ditert-butyl-2-methoxyphenyl)methylideneamino]-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 58531885 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 2-[(3,5-ditert-butyl-2-methoxyphenyl)methylideneamino]-2,2-diphenylacetic acid |
| SMILES | COc1c(/C=N/C(C(=O)O)(c2ccccc2)c2ccccc2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C30H35NO3/c1-28(2,3)24-18-21(26(34-7)25(19-24)29(4,5)6)20-31-30(27(32)33,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-20H,1-7H3,(H,32,33)/b31-20+ |
| InChIKey | KKUXDVFHFKRSRZ-AJBULDERSA-N |
| XLogP | 6.74 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|