C36H48O3 — CID 58805696
[2,6-ditert-butyl-4-(3,5-ditert-butyl-4-methoxyphenyl)phenyl] benzoate (PubChem CID 58805696) has the molecular formula C36H48O3 and a molecular weight of 528.78 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-(3,5-ditert-butyl-4-methoxyphenyl)phenyl] benzoate.
| Compound Name | [2,6-ditert-butyl-4-(3,5-ditert-butyl-4-methoxyphenyl)phenyl] benzoate |
|---|---|
| PubChem CID | 58805696 |
| Molecular Formula | C36H48O3 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | [2,6-ditert-butyl-4-(3,5-ditert-butyl-4-methoxyphenyl)phenyl] benzoate |
| SMILES | COc1c(C(C)(C)C)cc(-c2cc(C(C)(C)C)c(OC(=O)c3ccccc3)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C36H48O3/c1-33(2,3)26-19-24(20-27(30(26)38-13)34(4,5)6)25-21-28(35(7,8)9)31(29(22-25)36(10,11)12)39-32(37)23-17-15-14-16-18-23/h14-22H,1-13H3 |
| InChIKey | HTWQOXCZEDEMGZ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|