C25H26O3 — CID 23593069
[4-[(4-methoxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] benzoate (PubChem CID 23593069) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is [4-[(4-methoxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] benzoate.
| Compound Name | [4-[(4-methoxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] benzoate |
|---|---|
| PubChem CID | 23593069 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [4-[(4-methoxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] benzoate |
| SMILES | COc1c(C)cc(Cc2cc(C)c(OC(=O)c3ccccc3)c(C)c2)cc1C |
| InChI | InChI=1S/C25H26O3/c1-16-11-20(12-17(2)23(16)27-5)15-21-13-18(3)24(19(4)14-21)28-25(26)22-9-7-6-8-10-22/h6-14H,15H2,1-5H3 |
| InChIKey | PYBOMTPVACHDAP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|