C21H25NO5 — CID 22612992
4-(5-benzyl-2-methoxy-3-methylphenyl)-2,4-dioxobutanoic acid;N-methylmethanamine (PubChem CID 22612992) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-(5-benzyl-2-methoxy-3-methylphenyl)-2,4-dioxobutanoic acid;N-methylmethanamine.
| Compound Name | 4-(5-benzyl-2-methoxy-3-methylphenyl)-2,4-dioxobutanoic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 22612992 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4-(5-benzyl-2-methoxy-3-methylphenyl)-2,4-dioxobutanoic acid;N-methylmethanamine |
| SMILES | CNC.COc1c(C)cc(Cc2ccccc2)cc1C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C19H18O5.C2H7N/c1-12-8-14(9-13-6-4-3-5-7-13)10-15(18(12)24-2)16(20)11-17(21)19(22)23;1-3-2/h3-8,10H,9,11H2,1-2H3,(H,22,23);3H,1-2H3 |
| InChIKey | BSJODMPGKYZPNE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|