C21H23NO5 — CID 18736267
4-[5-benzyl-3-[(dimethylamino)methyl]-2-methoxyphenyl]-2,4-dioxobutanoic acid (PubChem CID 18736267) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[5-benzyl-3-[(dimethylamino)methyl]-2-methoxyphenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[5-benzyl-3-[(dimethylamino)methyl]-2-methoxyphenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 18736267 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-[5-benzyl-3-[(dimethylamino)methyl]-2-methoxyphenyl]-2,4-dioxobutanoic acid |
| SMILES | COc1c(CN(C)C)cc(Cc2ccccc2)cc1C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C21H23NO5/c1-22(2)13-16-10-15(9-14-7-5-4-6-8-14)11-17(20(16)27-3)18(23)12-19(24)21(25)26/h4-8,10-11H,9,12-13H2,1-3H3,(H,25,26) |
| InChIKey | ZOMCEHOKZNBHIM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|