C10H15NO3 — CID 69138278
carbonic acid;N,N-dimethyl-1-phenylmethanamine (PubChem CID 69138278) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is carbonic acid;N,N-dimethyl-1-phenylmethanamine.
| Compound Name | carbonic acid;N,N-dimethyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 69138278 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | carbonic acid;N,N-dimethyl-1-phenylmethanamine |
| SMILES | CN(C)Cc1ccccc1.O=C(O)O |
| InChI | InChI=1S/C9H13N.CH2O3/c1-10(2)8-9-6-4-3-5-7-9;2-1(3)4/h3-7H,8H2,1-2H3;(H2,2,3,4) |
| InChIKey | UARXKNMXNAYEPD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |