C9H13AuCl2N+ — CID 71592559
N,N-dimethyl-1-phenylmethanamine;gold(3+);dichloride (PubChem CID 71592559) has the molecular formula C9H13AuCl2N+ and a molecular weight of 403.08 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;gold(3+);dichloride.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;gold(3+);dichloride |
|---|---|
| PubChem CID | 71592559 |
| Molecular Formula | C9H13AuCl2N+ |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;gold(3+);dichloride |
| SMILES | CN(C)Cc1ccccc1.[Au+3].[Cl-].[Cl-] |
| InChI | InChI=1S/C9H13N.Au.2ClH/c1-10(2)8-9-6-4-3-5-7-9;;;/h3-7H,8H2,1-2H3;;2*1H/q;+3;;/p-2 |
| InChIKey | OZJJCINBEVVUPR-UHFFFAOYSA-L |
| XLogP | -4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |