C21H37N — CID 90785154
benzene;N,N-dimethyl-1-phenylmethanamine;ethane (PubChem CID 90785154) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is benzene;N,N-dimethyl-1-phenylmethanamine;ethane.
| Compound Name | benzene;N,N-dimethyl-1-phenylmethanamine;ethane |
|---|---|
| PubChem CID | 90785154 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | benzene;N,N-dimethyl-1-phenylmethanamine;ethane |
| SMILES | CC.CC.CC.CN(C)Cc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H13N.C6H6.3C2H6/c1-10(2)8-9-6-4-3-5-7-9;1-2-4-6-5-3-1;3*1-2/h3-7H,8H2,1-2H3;1-6H;3*1-2H3 |
| InChIKey | UNXHBRLWMZQRRW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |