C9H17Cl4N — CID 172854351
N,N-dimethyl-1-phenylmethanamine;tetrahydrochloride (PubChem CID 172854351) has the molecular formula C9H17Cl4N and a molecular weight of 281.05 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;tetrahydrochloride.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;tetrahydrochloride |
|---|---|
| PubChem CID | 172854351 |
| Molecular Formula | C9H17Cl4N |
| Molecular Weight | 281.05 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;tetrahydrochloride |
| SMILES | CN(C)Cc1ccccc1.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C9H13N.4ClH/c1-10(2)8-9-6-4-3-5-7-9;;;;/h3-7H,8H2,1-2H3;4*1H |
| InChIKey | YMMUNBDXJFUBSL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.05 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |