C16H23Cl3N2 — CID 175067673
N-chloro-1-phenylmethanamine;N,N-dimethyl-1-phenylmethanamine;dihydrochloride (PubChem CID 175067673) has the molecular formula C16H23Cl3N2 and a molecular weight of 349.73 g/mol. Its IUPAC name is N-chloro-1-phenylmethanamine;N,N-dimethyl-1-phenylmethanamine;dihydrochloride.
| Compound Name | N-chloro-1-phenylmethanamine;N,N-dimethyl-1-phenylmethanamine;dihydrochloride |
|---|---|
| PubChem CID | 175067673 |
| Molecular Formula | C16H23Cl3N2 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-chloro-1-phenylmethanamine;N,N-dimethyl-1-phenylmethanamine;dihydrochloride |
| SMILES | CN(C)Cc1ccccc1.Cl.Cl.ClNCc1ccccc1 |
| InChI | InChI=1S/C9H13N.C7H8ClN.2ClH/c1-10(2)8-9-6-4-3-5-7-9;8-9-6-7-4-2-1-3-5-7;;/h3-7H,8H2,1-2H3;1-5,9H,6H2;2*1H |
| InChIKey | DLIAODDNWUITFM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|