C15H18N2 — CID 57145827
1,2-dibenzyl-1-methylhydrazine (PubChem CID 57145827) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,2-dibenzyl-1-methylhydrazine.
| Compound Name | 1,2-dibenzyl-1-methylhydrazine |
|---|---|
| PubChem CID | 57145827 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1,2-dibenzyl-1-methylhydrazine |
| SMILES | CN(Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C15H18N2/c1-17(13-15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3 |
| InChIKey | ZYLKOVHPEPDIDJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|