C9H16NP — CID 174524909
N,N-dimethyl-1-phenylmethanamine;phosphane (PubChem CID 174524909) has the molecular formula C9H16NP and a molecular weight of 169.21 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;phosphane.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;phosphane |
|---|---|
| PubChem CID | 174524909 |
| Molecular Formula | C9H16NP |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;phosphane |
| SMILES | CN(C)Cc1ccccc1.P |
| InChI | InChI=1S/C9H13N.H3P/c1-10(2)8-9-6-4-3-5-7-9;/h3-7H,8H2,1-2H3;1H3 |
| InChIKey | HGNMCTGHBGKCGG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|