C13H25N2O+ — CID 173434737
N,N-dimethyl-1-phenylmethanamine;ethyl-hydroxy-dimethylazanium (PubChem CID 173434737) has the molecular formula C13H25N2O+ and a molecular weight of 225.36 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;ethyl-hydroxy-dimethylazanium.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;ethyl-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 173434737 |
| Molecular Formula | C13H25N2O+ |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;ethyl-hydroxy-dimethylazanium |
| SMILES | CC[N+](C)(C)O.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N.C4H12NO/c1-10(2)8-9-6-4-3-5-7-9;1-4-5(2,3)6/h3-7H,8H2,1-2H3;6H,4H2,1-3H3/q;+1 |
| InChIKey | PATVGMRRSVKMQP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|