C12H21NO3S — CID 173055418
N,N-dimethyl-1-phenylmethanamine;propane-1-sulfonic acid (PubChem CID 173055418) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;propane-1-sulfonic acid.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173055418 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N.C3H8O3S/c1-10(2)8-9-6-4-3-5-7-9;1-2-3-7(4,5)6/h3-7H,8H2,1-2H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | KVAWKSIMYXQBIM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|