C15H23NO2 — CID 173041614
N,N-dimethyl-1-phenylmethanamine;2-methylidenepentanoic acid (PubChem CID 173041614) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;2-methylidenepentanoic acid.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 173041614 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;2-methylidenepentanoic acid |
| SMILES | C=C(CCC)C(=O)O.CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N.C6H10O2/c1-10(2)8-9-6-4-3-5-7-9;1-3-4-5(2)6(7)8/h3-7H,8H2,1-2H3;2-4H2,1H3,(H,7,8) |
| InChIKey | NRFARTRJYVCHNF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|