C15H24ClNO2 — CID 173067916
N,N-dimethyl-1-phenylmethanamine;ethyl 2-methylprop-2-enoate;hydrochloride (PubChem CID 173067916) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is N,N-dimethyl-1-phenylmethanamine;ethyl 2-methylprop-2-enoate;hydrochloride.
| Compound Name | N,N-dimethyl-1-phenylmethanamine;ethyl 2-methylprop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 173067916 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N,N-dimethyl-1-phenylmethanamine;ethyl 2-methylprop-2-enoate;hydrochloride |
| SMILES | C=C(C)C(=O)OCC.CN(C)Cc1ccccc1.Cl |
| InChI | InChI=1S/C9H13N.C6H10O2.ClH/c1-10(2)8-9-6-4-3-5-7-9;1-4-8-6(7)5(2)3;/h3-7H,8H2,1-2H3;2,4H2,1,3H3;1H |
| InChIKey | BXUULZJBSDRIOL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|