About ethyl 2-methylprop-2-enoate
ethyl 2-methylprop-2-enoate (PubChem CID 130475774) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate |
| PubChem CID | 130475774 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.C=C(C)C(=O)OCC |
| InChI | InChI=1S/2C6H10O2/c2*1-4-8-6(7)5(2)3/h2*2,4H2,1,3H3 |
| InChIKey | NWKGQLFESXYSBK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate?
The IUPAC name of ethyl 2-methylprop-2-enoate (CID 130475774) is ethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethyl 2-methylprop-2-enoate?
The canonical SMILES for ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.C=C(C)C(=O)OCC.
What is the InChIKey of ethyl 2-methylprop-2-enoate?
The InChIKey is NWKGQLFESXYSBK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O2/c2*1-4-8-6(7)5(2)3/h2*2,4H2,1,3H3.
What are the key properties of ethyl 2-methylprop-2-enoate?
ethyl 2-methylprop-2-enoate has a molecular weight of 228.29 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 130475774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).