About ethane;bis(ethyl 2-methylprop-2-enoate)
ethane;bis(ethyl 2-methylprop-2-enoate) (PubChem CID 146295289) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is ethane;bis(ethyl 2-methylprop-2-enoate).
Molecular Properties
| Compound Name | ethane;bis(ethyl 2-methylprop-2-enoate) |
| PubChem CID | 146295289 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | ethane;bis(ethyl 2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)OCC.C=C(C)C(=O)OCC.CC |
| InChI | InChI=1S/2C6H10O2.C2H6/c2*1-4-8-6(7)5(2)3;1-2/h2*2,4H2,1,3H3;1-2H3 |
| InChIKey | HQGFYZCOZZKRFU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;bis(ethyl 2-methylprop-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;bis(ethyl 2-methylprop-2-enoate)?
The IUPAC name of ethane;bis(ethyl 2-methylprop-2-enoate) (CID 146295289) is ethane;bis(ethyl 2-methylprop-2-enoate).
What is the SMILES notation for ethane;bis(ethyl 2-methylprop-2-enoate)?
The canonical SMILES for ethane;bis(ethyl 2-methylprop-2-enoate) is C=C(C)C(=O)OCC.C=C(C)C(=O)OCC.CC.
What is the InChIKey of ethane;bis(ethyl 2-methylprop-2-enoate)?
The InChIKey is HQGFYZCOZZKRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O2.C2H6/c2*1-4-8-6(7)5(2)3;1-2/h2*2,4H2,1,3H3;1-2H3.
What are the key properties of ethane;bis(ethyl 2-methylprop-2-enoate)?
ethane;bis(ethyl 2-methylprop-2-enoate) has a molecular weight of 258.36 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;bis(ethyl 2-methylprop-2-enoate) is sourced from PubChem (CID 146295289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).