About ethyl 2-methylprop-2-enoate;phosphane
ethyl 2-methylprop-2-enoate;phosphane (PubChem CID 159151613) has the molecular formula C6H13O2P
and a molecular weight of 148.14 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;phosphane.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate;phosphane |
| PubChem CID | 159151613 |
| Molecular Formula | C6H13O2P |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;phosphane |
| SMILES | C=C(C)C(=O)OCC.P |
| InChI | InChI=1S/C6H10O2.H3P/c1-4-8-6(7)5(2)3;/h2,4H2,1,3H3;1H3 |
| InChIKey | RBLPFAMYJLVKCG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate;phosphane?
The IUPAC name of ethyl 2-methylprop-2-enoate;phosphane (CID 159151613) is ethyl 2-methylprop-2-enoate;phosphane.
What is the SMILES notation for ethyl 2-methylprop-2-enoate;phosphane?
The canonical SMILES for ethyl 2-methylprop-2-enoate;phosphane is C=C(C)C(=O)OCC.P.
What is the InChIKey of ethyl 2-methylprop-2-enoate;phosphane?
The InChIKey is RBLPFAMYJLVKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.H3P/c1-4-8-6(7)5(2)3;/h2,4H2,1,3H3;1H3.
What are the key properties of ethyl 2-methylprop-2-enoate;phosphane?
ethyl 2-methylprop-2-enoate;phosphane has a molecular weight of 148.14 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate;phosphane is sourced from PubChem (CID 159151613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).