About ethenol;ethyl 2-methylprop-2-enoate
ethenol;ethyl 2-methylprop-2-enoate (PubChem CID 174606807) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethenol;ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethenol;ethyl 2-methylprop-2-enoate |
| PubChem CID | 174606807 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | ethenol;ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC.C=CO |
| InChI | InChI=1S/C6H10O2.C2H4O/c1-4-8-6(7)5(2)3;1-2-3/h2,4H2,1,3H3;2-3H,1H2 |
| InChIKey | GCQDGTIXYXKBNP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenol;ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;ethyl 2-methylprop-2-enoate?
The IUPAC name of ethenol;ethyl 2-methylprop-2-enoate (CID 174606807) is ethenol;ethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethenol;ethyl 2-methylprop-2-enoate?
The canonical SMILES for ethenol;ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC.C=CO.
What is the InChIKey of ethenol;ethyl 2-methylprop-2-enoate?
The InChIKey is GCQDGTIXYXKBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C2H4O/c1-4-8-6(7)5(2)3;1-2-3/h2,4H2,1,3H3;2-3H,1H2.
What are the key properties of ethenol;ethyl 2-methylprop-2-enoate?
ethenol;ethyl 2-methylprop-2-enoate has a molecular weight of 158.20 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 174606807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).