About ethyl 2-methylprop-2-enoate;methane
ethyl 2-methylprop-2-enoate;methane (PubChem CID 159235789) has the molecular formula C9H22O2
and a molecular weight of 162.27 g/mol. Its IUPAC name is ethyl 2-methylprop-2-enoate;methane.
Molecular Properties
| Compound Name | ethyl 2-methylprop-2-enoate;methane |
| PubChem CID | 159235789 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.16 |
| IUPAC Name | ethyl 2-methylprop-2-enoate;methane |
| SMILES | C.C.C.C=C(C)C(=O)OCC |
| InChI | InChI=1S/C6H10O2.3CH4/c1-4-8-6(7)5(2)3;;;/h2,4H2,1,3H3;3*1H4 |
| InChIKey | KTLLHVCXMVUHAB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylprop-2-enoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylprop-2-enoate;methane?
The IUPAC name of ethyl 2-methylprop-2-enoate;methane (CID 159235789) is ethyl 2-methylprop-2-enoate;methane.
What is the SMILES notation for ethyl 2-methylprop-2-enoate;methane?
The canonical SMILES for ethyl 2-methylprop-2-enoate;methane is C.C.C.C=C(C)C(=O)OCC.
What is the InChIKey of ethyl 2-methylprop-2-enoate;methane?
The InChIKey is KTLLHVCXMVUHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.3CH4/c1-4-8-6(7)5(2)3;;;/h2,4H2,1,3H3;3*1H4.
What are the key properties of ethyl 2-methylprop-2-enoate;methane?
ethyl 2-methylprop-2-enoate;methane has a molecular weight of 162.27 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylprop-2-enoate;methane is sourced from PubChem (CID 159235789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).